C15H19N5O2 — CID 155505228
N-[(3R,7R,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-1H-pyrazolo[5,4-b]pyridine-6-carboxamide (PubChem CID 155505228) has the molecular formula C15H19N5O2 and a molecular weight of 301.35 g/mol. Its IUPAC name is N-[(3R,7R,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-1H-pyrazolo[5,4-b]pyridine-6-carboxamide.
| Compound Name | N-[(3R,7R,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-1H-pyrazolo[5,4-b]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 155505228 |
| Molecular Formula | C15H19N5O2 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | N-[(3R,7R,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-1H-pyrazolo[5,4-b]pyridine-6-carboxamide |
| SMILES | C[C@@H]1CN2C[C@H](NC(=O)c3ccc4cn[nH]c4n3)C[C@H]2CO1 |
| InChI | InChI=1S/C15H19N5O2/c1-9-6-20-7-11(4-12(20)8-22-9)17-15(21)13-3-2-10-5-16-19-14(10)18-13/h2-3,5,9,11-12H,4,6-8H2,1H3,(H,17,21)(H,16,18,19)/t9-,11-,12+/m1/s1 |
| InChIKey | BSRJCBWGRUQQBS-JLLWLGSASA-N |
| XLogP | 0.55 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |