About 6-(2-chloroethoxy)-1,3-difluoro-10H-acridin-9-one
6-(2-chloroethoxy)-1,3-difluoro-10H-acridin-9-one (PubChem CID 155513902) has the molecular formula C15H10ClF2NO2
and a molecular weight of 309.70 g/mol. Its IUPAC name is 6-(2-chloroethoxy)-1,3-difluoro-10H-acridin-9-one.
Molecular Properties
| Compound Name | 6-(2-chloroethoxy)-1,3-difluoro-10H-acridin-9-one |
| PubChem CID | 155513902 |
| Molecular Formula | C15H10ClF2NO2 |
| Molecular Weight | 309.70 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | 6-(2-chloroethoxy)-1,3-difluoro-10H-acridin-9-one |
| SMILES | O=c1c2ccc(OCCCl)cc2[nH]c2cc(F)cc(F)c12 |
| InChI | InChI=1S/C15H10ClF2NO2/c16-3-4-21-9-1-2-10-12(7-9)19-13-6-8(17)5-11(18)14(13)15(10)20/h1-2,5-7H,3-4H2,(H,19,20) |
| InChIKey | DNHWDDVRRSVMCY-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.70 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 6-(2-chloroethoxy)-1,3-difluoro-10H-acridin-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-chloroethoxy)-1,3-difluoro-10H-acridin-9-one?
The IUPAC name of 6-(2-chloroethoxy)-1,3-difluoro-10H-acridin-9-one (CID 155513902) is 6-(2-chloroethoxy)-1,3-difluoro-10H-acridin-9-one.
What is the SMILES notation for 6-(2-chloroethoxy)-1,3-difluoro-10H-acridin-9-one?
The canonical SMILES for 6-(2-chloroethoxy)-1,3-difluoro-10H-acridin-9-one is O=c1c2ccc(OCCCl)cc2[nH]c2cc(F)cc(F)c12.
What is the InChIKey of 6-(2-chloroethoxy)-1,3-difluoro-10H-acridin-9-one?
The InChIKey is DNHWDDVRRSVMCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10ClF2NO2/c16-3-4-21-9-1-2-10-12(7-9)19-13-6-8(17)5-11(18)14(13)15(10)20/h1-2,5-7H,3-4H2,(H,19,20).
What are the key properties of 6-(2-chloroethoxy)-1,3-difluoro-10H-acridin-9-one?
6-(2-chloroethoxy)-1,3-difluoro-10H-acridin-9-one has a molecular weight of 309.70 g/mol, XLogP of 3.58, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-chloroethoxy)-1,3-difluoro-10H-acridin-9-one is sourced from PubChem (CID 155513902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).