C15H10ClF2NO2 — CID 155513902
6-(2-chloroethoxy)-1,3-difluoro-10H-acridin-9-one (PubChem CID 155513902) has the molecular formula C15H10ClF2NO2 and a molecular weight of 309.70 g/mol. Its IUPAC name is 6-(2-chloroethoxy)-1,3-difluoro-10H-acridin-9-one.
| Compound Name | 6-(2-chloroethoxy)-1,3-difluoro-10H-acridin-9-one |
|---|---|
| PubChem CID | 155513902 |
| Molecular Formula | C15H10ClF2NO2 |
| Molecular Weight | 309.70 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | 6-(2-chloroethoxy)-1,3-difluoro-10H-acridin-9-one |
| SMILES | O=c1c2ccc(OCCCl)cc2[nH]c2cc(F)cc(F)c12 |
| InChI | InChI=1S/C15H10ClF2NO2/c16-3-4-21-9-1-2-10-12(7-9)19-13-6-8(17)5-11(18)14(13)15(10)20/h1-2,5-7H,3-4H2,(H,19,20) |
| InChIKey | DNHWDDVRRSVMCY-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.70 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|