C30H30N4O5S — CID 155525771
N-(2-aminophenyl)-4-[[[1-(3,4-dimethoxyphenyl)sulfonyl-2,3-dihydroindol-7-yl]amino]methyl]benzamide (PubChem CID 155525771) has the molecular formula C30H30N4O5S and a molecular weight of 558.66 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[[[1-(3,4-dimethoxyphenyl)sulfonyl-2,3-dihydroindol-7-yl]amino]methyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[[[1-(3,4-dimethoxyphenyl)sulfonyl-2,3-dihydroindol-7-yl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 155525771 |
| Molecular Formula | C30H30N4O5S |
| Molecular Weight | 558.66 g/mol |
| Exact Mass | 558.19 |
| IUPAC Name | N-(2-aminophenyl)-4-[[[1-(3,4-dimethoxyphenyl)sulfonyl-2,3-dihydroindol-7-yl]amino]methyl]benzamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCc3cccc(NCc4ccc(C(=O)Nc5ccccc5N)cc4)c32)cc1OC |
| InChI | InChI=1S/C30H30N4O5S/c1-38-27-15-14-23(18-28(27)39-2)40(36,37)34-17-16-21-6-5-9-26(29(21)34)32-19-20-10-12-22(13-11-20)30(35)33-25-8-4-3-7-24(25)31/h3-15,18,32H,16-17,19,31H2,1-2H3,(H,33,35) |
| InChIKey | ITXLNWUOTYXOND-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 122.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.66 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|