C29H28N4O4S — CID 155565261
N-(2-aminophenyl)-4-[[[1-(3-methoxyphenyl)sulfonyl-2,3-dihydroindol-7-yl]amino]methyl]benzamide (PubChem CID 155565261) has the molecular formula C29H28N4O4S and a molecular weight of 528.63 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[[[1-(3-methoxyphenyl)sulfonyl-2,3-dihydroindol-7-yl]amino]methyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[[[1-(3-methoxyphenyl)sulfonyl-2,3-dihydroindol-7-yl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 155565261 |
| Molecular Formula | C29H28N4O4S |
| Molecular Weight | 528.63 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | N-(2-aminophenyl)-4-[[[1-(3-methoxyphenyl)sulfonyl-2,3-dihydroindol-7-yl]amino]methyl]benzamide |
| SMILES | COc1cccc(S(=O)(=O)N2CCc3cccc(NCc4ccc(C(=O)Nc5ccccc5N)cc4)c32)c1 |
| InChI | InChI=1S/C29H28N4O4S/c1-37-23-7-5-8-24(18-23)38(35,36)33-17-16-21-6-4-11-27(28(21)33)31-19-20-12-14-22(15-13-20)29(34)32-26-10-3-2-9-25(26)30/h2-15,18,31H,16-17,19,30H2,1H3,(H,32,34) |
| InChIKey | BMQPRKTXMJQIHV-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.63 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|