C31H29ClN3O4S+ — CID 155528503
6-chloro-N-[5-[(17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl)oxy]pentyl]-1,3-benzothiazol-2-amine (PubChem CID 155528503) has the molecular formula C31H29ClN3O4S+ and a molecular weight of 575.11 g/mol. Its IUPAC name is 6-chloro-N-[5-[(17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl)oxy]pentyl]-1,3-benzothiazol-2-amine.
| Compound Name | 6-chloro-N-[5-[(17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl)oxy]pentyl]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 155528503 |
| Molecular Formula | C31H29ClN3O4S+ |
| Molecular Weight | 575.11 g/mol |
| Exact Mass | 574.16 |
| IUPAC Name | 6-chloro-N-[5-[(17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl)oxy]pentyl]-1,3-benzothiazol-2-amine |
| SMILES | COc1ccc2cc3[n+](cc2c1OCCCCCNc1nc2ccc(Cl)cc2s1)CCc1cc2c(cc1-3)OCO2 |
| InChI | InChI=1S/C31H29ClN3O4S/c1-36-26-8-5-19-13-25-22-16-28-27(38-18-39-28)14-20(22)9-11-35(25)17-23(19)30(26)37-12-4-2-3-10-33-31-34-24-7-6-21(32)15-29(24)40-31/h5-8,13-17H,2-4,9-12,18H2,1H3,(H,33,34)/q+1 |
| InChIKey | BEUCPNGPACXHPX-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.11 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|