C27H24N2Na2O10 — CID 155530081
disodium;2-[[2-[4-[(1E,3Z,6E)-7-[4-[2-(carboxylatomethylamino)-2-oxoethoxy]phenyl]-3-hydroxy-5-oxohepta-1,3,6-trienyl]phenoxy]acetyl]amino]acetate (PubChem CID 155530081) has the molecular formula C27H24N2Na2O10 and a molecular weight of 582.47 g/mol. Its IUPAC name is disodium;2-[[2-[4-[(1E,3Z,6E)-7-[4-[2-(carboxylatomethylamino)-2-oxoethoxy]phenyl]-3-hydroxy-5-oxohepta-1,3,6-trienyl]phenoxy]acetyl]amino]acetate.
| Compound Name | disodium;2-[[2-[4-[(1E,3Z,6E)-7-[4-[2-(carboxylatomethylamino)-2-oxoethoxy]phenyl]-3-hydroxy-5-oxohepta-1,3,6-trienyl]phenoxy]acetyl]amino]acetate |
|---|---|
| PubChem CID | 155530081 |
| Molecular Formula | C27H24N2Na2O10 |
| Molecular Weight | 582.47 g/mol |
| Exact Mass | 582.12 |
| IUPAC Name | disodium;2-[[2-[4-[(1E,3Z,6E)-7-[4-[2-(carboxylatomethylamino)-2-oxoethoxy]phenyl]-3-hydroxy-5-oxohepta-1,3,6-trienyl]phenoxy]acetyl]amino]acetate |
| SMILES | O=C(/C=C(O)/C=C/c1ccc(OCC(=O)NCC(=O)[O-])cc1)/C=C/c1ccc(OCC(=O)NCC(=O)[O-])cc1.[Na+].[Na+] |
| InChI | InChI=1S/C27H26N2O10.2Na/c30-20(7-1-18-3-9-22(10-4-18)38-16-24(32)28-14-26(34)35)13-21(31)8-2-19-5-11-23(12-6-19)39-17-25(33)29-15-27(36)37;;/h1-13,30H,14-17H2,(H,28,32)(H,29,33)(H,34,35)(H,36,37);;/q;2*+1/p-2/b7-1+,8-2+,20-13-;; |
| InChIKey | BMPWKVPMTQIART-TXPLFJOKSA-L |
| XLogP | -7.08 |
| TPSA | 194.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.47 |
| LogP ≤ 5 | -7.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|