C33H36ClN3O7 — CID 155534323
methyl 2-[[6-chloro-1-[4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]amino]benzoate (PubChem CID 155534323) has the molecular formula C33H36ClN3O7 and a molecular weight of 622.12 g/mol. Its IUPAC name is methyl 2-[[6-chloro-1-[4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]amino]benzoate.
| Compound Name | methyl 2-[[6-chloro-1-[4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 155534323 |
| Molecular Formula | C33H36ClN3O7 |
| Molecular Weight | 622.12 g/mol |
| Exact Mass | 621.22 |
| IUPAC Name | methyl 2-[[6-chloro-1-[4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]amino]benzoate |
| SMILES | COCCOCCOCCOc1ccc(C2c3[nH]c4ccc(Cl)cc4c3CCN2C(=O)Nc2ccccc2C(=O)OC)cc1 |
| InChI | InChI=1S/C33H36ClN3O7/c1-40-15-16-42-17-18-43-19-20-44-24-10-7-22(8-11-24)31-30-25(27-21-23(34)9-12-29(27)35-30)13-14-37(31)33(39)36-28-6-4-3-5-26(28)32(38)41-2/h3-12,21,31,35H,13-20H2,1-2H3,(H,36,39) |
| InChIKey | UWXWSDURKQASCB-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 111.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.12 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|