C17H15BrClN5S — CID 155534873
1-[(E)-(5-bromo-2-pyridinyl)methylideneamino]-3-[2-(5-chloro-1H-indol-3-yl)ethyl]thiourea (PubChem CID 155534873) has the molecular formula C17H15BrClN5S and a molecular weight of 436.77 g/mol. Its IUPAC name is 1-[(E)-(5-bromo-2-pyridinyl)methylideneamino]-3-[2-(5-chloro-1H-indol-3-yl)ethyl]thiourea.
| Compound Name | 1-[(E)-(5-bromo-2-pyridinyl)methylideneamino]-3-[2-(5-chloro-1H-indol-3-yl)ethyl]thiourea |
|---|---|
| PubChem CID | 155534873 |
| Molecular Formula | C17H15BrClN5S |
| Molecular Weight | 436.77 g/mol |
| Exact Mass | 434.99 |
| IUPAC Name | 1-[(E)-(5-bromo-2-pyridinyl)methylideneamino]-3-[2-(5-chloro-1H-indol-3-yl)ethyl]thiourea |
| SMILES | S=C(NCCc1c[nH]c2ccc(Cl)cc12)N/N=C/c1ccc(Br)cn1 |
| InChI | InChI=1S/C17H15BrClN5S/c18-12-1-3-14(21-9-12)10-23-24-17(25)20-6-5-11-8-22-16-4-2-13(19)7-15(11)16/h1-4,7-10,22H,5-6H2,(H2,20,24,25)/b23-10+ |
| InChIKey | DHVYZZUHLRRMMH-AUEPDCJTSA-N |
| XLogP | 4.02 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.77 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|