C19H20ClN3S — CID 17272253
1-[2-(5-chloro-1H-indol-3-yl)ethyl]-3-(3,5-dimethylphenyl)thiourea (PubChem CID 17272253) has the molecular formula C19H20ClN3S and a molecular weight of 357.91 g/mol. Its IUPAC name is 1-[2-(5-chloro-1H-indol-3-yl)ethyl]-3-(3,5-dimethylphenyl)thiourea.
| Compound Name | 1-[2-(5-chloro-1H-indol-3-yl)ethyl]-3-(3,5-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 17272253 |
| Molecular Formula | C19H20ClN3S |
| Molecular Weight | 357.91 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 1-[2-(5-chloro-1H-indol-3-yl)ethyl]-3-(3,5-dimethylphenyl)thiourea |
| SMILES | Cc1cc(C)cc(NC(=S)NCCc2c[nH]c3ccc(Cl)cc23)c1 |
| InChI | InChI=1S/C19H20ClN3S/c1-12-7-13(2)9-16(8-12)23-19(24)21-6-5-14-11-22-18-4-3-15(20)10-17(14)18/h3-4,7-11,22H,5-6H2,1-2H3,(H2,21,23,24) |
| InChIKey | XKPOCNHTSGGDIC-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 39.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.91 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|