C36H49ClN2OS — CID 155535487
10-[5-[[(2S,3R)-3-(4-octylphenyl)pyrrolidin-2-yl]methoxy]pentyl]phenothiazine;hydrochloride (PubChem CID 155535487) has the molecular formula C36H49ClN2OS and a molecular weight of 593.32 g/mol. Its IUPAC name is 10-[5-[[(2S,3R)-3-(4-octylphenyl)pyrrolidin-2-yl]methoxy]pentyl]phenothiazine;hydrochloride.
| Compound Name | 10-[5-[[(2S,3R)-3-(4-octylphenyl)pyrrolidin-2-yl]methoxy]pentyl]phenothiazine;hydrochloride |
|---|---|
| PubChem CID | 155535487 |
| Molecular Formula | C36H49ClN2OS |
| Molecular Weight | 593.32 g/mol |
| Exact Mass | 592.33 |
| IUPAC Name | 10-[5-[[(2S,3R)-3-(4-octylphenyl)pyrrolidin-2-yl]methoxy]pentyl]phenothiazine;hydrochloride |
| SMILES | CCCCCCCCc1ccc([C@H]2CCN[C@@H]2COCCCCCN2c3ccccc3Sc3ccccc32)cc1.Cl |
| InChI | InChI=1S/C36H48N2OS.ClH/c1-2-3-4-5-6-8-15-29-20-22-30(23-21-29)31-24-25-37-32(31)28-39-27-14-7-13-26-38-33-16-9-11-18-35(33)40-36-19-12-10-17-34(36)38;/h9-12,16-23,31-32,37H,2-8,13-15,24-28H2,1H3;1H/t31-,32-;/m1./s1 |
| InChIKey | KSOKUXKMTBCRBK-JOVGIXRXSA-N |
| XLogP | 9.95 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.32 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|