C27H22FN7O4 — CID 155535752
1-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-3-[(E)-[1-(4-fluorophenyl)triazol-4-yl]methylideneamino]urea (PubChem CID 155535752) has the molecular formula C27H22FN7O4 and a molecular weight of 527.52 g/mol. Its IUPAC name is 1-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-3-[(E)-[1-(4-fluorophenyl)triazol-4-yl]methylideneamino]urea.
| Compound Name | 1-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-3-[(E)-[1-(4-fluorophenyl)triazol-4-yl]methylideneamino]urea |
|---|---|
| PubChem CID | 155535752 |
| Molecular Formula | C27H22FN7O4 |
| Molecular Weight | 527.52 g/mol |
| Exact Mass | 527.17 |
| IUPAC Name | 1-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-3-[(E)-[1-(4-fluorophenyl)triazol-4-yl]methylideneamino]urea |
| SMILES | COc1cc2nccc(Oc3ccc(NC(=O)N/N=C/c4cn(-c5ccc(F)cc5)nn4)cc3)c2cc1OC |
| InChI | InChI=1S/C27H22FN7O4/c1-37-25-13-22-23(14-26(25)38-2)29-12-11-24(22)39-21-9-5-18(6-10-21)31-27(36)33-30-15-19-16-35(34-32-19)20-7-3-17(28)4-8-20/h3-16H,1-2H3,(H2,31,33,36)/b30-15+ |
| InChIKey | CLLJHGQBMJTRBU-FJEPWZHXSA-N |
| XLogP | 4.92 |
| TPSA | 124.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.52 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|