C24H25NO3 — CID 155535757
(2E)-2-[(3,4-diethoxyphenyl)methylidene]-8-methyl-4,9-dihydro-3H-carbazol-1-one (PubChem CID 155535757) has the molecular formula C24H25NO3 and a molecular weight of 375.47 g/mol. Its IUPAC name is (2E)-2-[(3,4-diethoxyphenyl)methylidene]-8-methyl-4,9-dihydro-3H-carbazol-1-one.
| Compound Name | (2E)-2-[(3,4-diethoxyphenyl)methylidene]-8-methyl-4,9-dihydro-3H-carbazol-1-one |
|---|---|
| PubChem CID | 155535757 |
| Molecular Formula | C24H25NO3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | (2E)-2-[(3,4-diethoxyphenyl)methylidene]-8-methyl-4,9-dihydro-3H-carbazol-1-one |
| SMILES | CCOc1ccc(/C=C2\CCc3c([nH]c4c(C)cccc34)C2=O)cc1OCC |
| InChI | InChI=1S/C24H25NO3/c1-4-27-20-12-9-16(14-21(20)28-5-2)13-17-10-11-19-18-8-6-7-15(3)22(18)25-23(19)24(17)26/h6-9,12-14,25H,4-5,10-11H2,1-3H3/b17-13+ |
| InChIKey | ZVHMNQFHZXSWEG-GHRIWEEISA-N |
| XLogP | 5.49 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|