C26H30N4O — CID 155551882
N,N-dimethyl-3-[4-[6-(4-propan-2-ylphenyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]phenoxy]propan-1-amine (PubChem CID 155551882) has the molecular formula C26H30N4O and a molecular weight of 414.55 g/mol. Its IUPAC name is N,N-dimethyl-3-[4-[6-(4-propan-2-ylphenyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]phenoxy]propan-1-amine.
| Compound Name | N,N-dimethyl-3-[4-[6-(4-propan-2-ylphenyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]phenoxy]propan-1-amine |
|---|---|
| PubChem CID | 155551882 |
| Molecular Formula | C26H30N4O |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | N,N-dimethyl-3-[4-[6-(4-propan-2-ylphenyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]phenoxy]propan-1-amine |
| SMILES | CC(C)c1ccc(-c2ccc3nnc(-c4ccc(OCCCN(C)C)cc4)n3c2)cc1 |
| InChI | InChI=1S/C26H30N4O/c1-19(2)20-6-8-21(9-7-20)23-12-15-25-27-28-26(30(25)18-23)22-10-13-24(14-11-22)31-17-5-16-29(3)4/h6-15,18-19H,5,16-17H2,1-4H3 |
| InChIKey | UAVUMYRNWJSOSG-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 42.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|