C30H34O7 — CID 155555616
(1R,2R,3S,11R,12R,14R,15R,18S)-2,7,9-trihydroxy-3,15-dimethyl-11-phenyl-18-propan-2-yl-4,19-dioxapentacyclo[12.4.1.01,14.03,12.05,10]nonadeca-5,7,9-triene-6,8-dicarbaldehyde (PubChem CID 155555616) has the molecular formula C30H34O7 and a molecular weight of 506.60 g/mol. Its IUPAC name is (1R,2R,3S,11R,12R,14R,15R,18S)-2,7,9-trihydroxy-3,15-dimethyl-11-phenyl-18-propan-2-yl-4,19-dioxapentacyclo[12.4.1.01,14.03,12.05,10]nonadeca-5,7,9-triene-6,8-dicarbaldehyde.
| Compound Name | (1R,2R,3S,11R,12R,14R,15R,18S)-2,7,9-trihydroxy-3,15-dimethyl-11-phenyl-18-propan-2-yl-4,19-dioxapentacyclo[12.4.1.01,14.03,12.05,10]nonadeca-5,7,9-triene-6,8-dicarbaldehyde |
|---|---|
| PubChem CID | 155555616 |
| Molecular Formula | C30H34O7 |
| Molecular Weight | 506.60 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | (1R,2R,3S,11R,12R,14R,15R,18S)-2,7,9-trihydroxy-3,15-dimethyl-11-phenyl-18-propan-2-yl-4,19-dioxapentacyclo[12.4.1.01,14.03,12.05,10]nonadeca-5,7,9-triene-6,8-dicarbaldehyde |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)[C@]23C[C@@H]4[C@H](c5ccccc5)c5c(O)c(C=O)c(O)c(C=O)c5O[C@]4(C)[C@@H](O)[C@]12O3 |
| InChI | InChI=1S/C30H34O7/c1-15(2)20-11-10-16(3)29-12-21-22(17-8-6-5-7-9-17)23-25(34)18(13-31)24(33)19(14-32)26(23)36-28(21,4)27(35)30(20,29)37-29/h5-9,13-16,20-22,27,33-35H,10-12H2,1-4H3/t16-,20+,21-,22+,27-,28+,29-,30-/m1/s1 |
| InChIKey | GRODYRDGTCAMFI-JADLSCCISA-N |
| XLogP | 4.60 |
| TPSA | 116.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.60 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|