C25H26O5 — CID 163184205
(1'R,2R,4R,5'S)-5,7-dihydroxy-4-phenyl-1'-propan-2-ylspiro[3,4-dihydrochromene-2,4'-bicyclo[3.1.0]hexane]-6,8-dicarbaldehyde (PubChem CID 163184205) has the molecular formula C25H26O5 and a molecular weight of 406.48 g/mol. Its IUPAC name is (1'R,2R,4R,5'S)-5,7-dihydroxy-4-phenyl-1'-propan-2-ylspiro[3,4-dihydrochromene-2,4'-bicyclo[3.1.0]hexane]-6,8-dicarbaldehyde.
| Compound Name | (1'R,2R,4R,5'S)-5,7-dihydroxy-4-phenyl-1'-propan-2-ylspiro[3,4-dihydrochromene-2,4'-bicyclo[3.1.0]hexane]-6,8-dicarbaldehyde |
|---|---|
| PubChem CID | 163184205 |
| Molecular Formula | C25H26O5 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | (1'R,2R,4R,5'S)-5,7-dihydroxy-4-phenyl-1'-propan-2-ylspiro[3,4-dihydrochromene-2,4'-bicyclo[3.1.0]hexane]-6,8-dicarbaldehyde |
| SMILES | CC(C)[C@]12CC[C@@]3(C[C@H](c4ccccc4)c4c(O)c(C=O)c(O)c(C=O)c4O3)[C@H]1C2 |
| InChI | InChI=1S/C25H26O5/c1-14(2)24-8-9-25(19(24)11-24)10-16(15-6-4-3-5-7-15)20-22(29)17(12-26)21(28)18(13-27)23(20)30-25/h3-7,12-14,16,19,28-29H,8-11H2,1-2H3/t16-,19+,24-,25-/m1/s1 |
| InChIKey | OYVVKPBNGPLGSG-JPWAERFASA-N |
| XLogP | 4.83 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|