C28H25N3O5 — CID 155556561
[(1S,3R,3aR,4E,6aR)-3-benzoyloxy-4-(pyridine-4-carbonylhydrazinylidene)-2,3,3a,5,6,6a-hexahydro-1H-pentalen-1-yl] benzoate (PubChem CID 155556561) has the molecular formula C28H25N3O5 and a molecular weight of 483.52 g/mol. Its IUPAC name is [(1S,3R,3aR,4E,6aR)-3-benzoyloxy-4-(pyridine-4-carbonylhydrazinylidene)-2,3,3a,5,6,6a-hexahydro-1H-pentalen-1-yl] benzoate.
| Compound Name | [(1S,3R,3aR,4E,6aR)-3-benzoyloxy-4-(pyridine-4-carbonylhydrazinylidene)-2,3,3a,5,6,6a-hexahydro-1H-pentalen-1-yl] benzoate |
|---|---|
| PubChem CID | 155556561 |
| Molecular Formula | C28H25N3O5 |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | [(1S,3R,3aR,4E,6aR)-3-benzoyloxy-4-(pyridine-4-carbonylhydrazinylidene)-2,3,3a,5,6,6a-hexahydro-1H-pentalen-1-yl] benzoate |
| SMILES | O=C(N/N=C1\CC[C@@H]2[C@H]1[C@H](OC(=O)c1ccccc1)C[C@@H]2OC(=O)c1ccccc1)c1ccncc1 |
| InChI | InChI=1S/C28H25N3O5/c32-26(18-13-15-29-16-14-18)31-30-22-12-11-21-23(35-27(33)19-7-3-1-4-8-19)17-24(25(21)22)36-28(34)20-9-5-2-6-10-20/h1-10,13-16,21,23-25H,11-12,17H2,(H,31,32)/b30-22+/t21-,23-,24+,25+/m0/s1 |
| InChIKey | NJRRDHODIALAST-PKHQLOEWSA-N |
| XLogP | 4.05 |
| TPSA | 106.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|