C29H38O8 — CID 155565367
[(1S,3R,5R)-1,3-diacetyloxy-7,8-dimethyl-7-(3-methylidenepent-4-enyl)-10-oxo-3,5,6,6a,8,9-hexahydro-1H-benzo[d][2]benzofuran-5-yl] (Z)-2-methylbut-2-enoate (PubChem CID 155565367) has the molecular formula C29H38O8 and a molecular weight of 514.62 g/mol. Its IUPAC name is [(1S,3R,5R)-1,3-diacetyloxy-7,8-dimethyl-7-(3-methylidenepent-4-enyl)-10-oxo-3,5,6,6a,8,9-hexahydro-1H-benzo[d][2]benzofuran-5-yl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(1S,3R,5R)-1,3-diacetyloxy-7,8-dimethyl-7-(3-methylidenepent-4-enyl)-10-oxo-3,5,6,6a,8,9-hexahydro-1H-benzo[d][2]benzofuran-5-yl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 155565367 |
| Molecular Formula | C29H38O8 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.26 |
| IUPAC Name | [(1S,3R,5R)-1,3-diacetyloxy-7,8-dimethyl-7-(3-methylidenepent-4-enyl)-10-oxo-3,5,6,6a,8,9-hexahydro-1H-benzo[d][2]benzofuran-5-yl] (Z)-2-methylbut-2-enoate |
| SMILES | C=CC(=C)CCC1(C)C(C)CC(=O)C23C(=C[C@H](OC(=O)/C(C)=C\C)CC12)[C@@H](OC(C)=O)O[C@H]3OC(C)=O |
| InChI | InChI=1S/C29H38O8/c1-9-16(3)11-12-28(8)18(5)13-24(32)29-22(26(34-19(6)30)37-27(29)35-20(7)31)14-21(15-23(28)29)36-25(33)17(4)10-2/h9-10,14,18,21,23,26-27H,1,3,11-13,15H2,2,4-8H3/b17-10-/t18?,21-,23?,26-,27+,28?,29?/m0/s1 |
| InChIKey | JKCXNRZEWVHSJN-IKTUVGAPSA-N |
| XLogP | 4.74 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|