C38H52O11 — CID 75971630
[1,3,5,10-tetraacetyloxy-7,8-dimethyl-7-(3-methylidenepent-4-enyl)-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-9-yl] deca-2,4-dienoate (PubChem CID 75971630) has the molecular formula C38H52O11 and a molecular weight of 684.82 g/mol. Its IUPAC name is [1,3,5,10-tetraacetyloxy-7,8-dimethyl-7-(3-methylidenepent-4-enyl)-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-9-yl] deca-2,4-dienoate.
| Compound Name | [1,3,5,10-tetraacetyloxy-7,8-dimethyl-7-(3-methylidenepent-4-enyl)-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-9-yl] deca-2,4-dienoate |
|---|---|
| PubChem CID | 75971630 |
| Molecular Formula | C38H52O11 |
| Molecular Weight | 684.82 g/mol |
| Exact Mass | 684.35 |
| IUPAC Name | [1,3,5,10-tetraacetyloxy-7,8-dimethyl-7-(3-methylidenepent-4-enyl)-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-9-yl] deca-2,4-dienoate |
| SMILES | C=CC(=C)CCC1(C)C(C)C(OC(=O)C=CC=CCCCCC)C(OC(C)=O)C23C(=CC(OC(C)=O)CC12)C(OC(C)=O)OC3OC(C)=O |
| InChI | InChI=1S/C38H52O11/c1-10-12-13-14-15-16-17-18-32(43)48-33-24(4)37(9,20-19-23(3)11-2)31-22-29(44-25(5)39)21-30-35(46-27(7)41)49-36(47-28(8)42)38(30,31)34(33)45-26(6)40/h11,15-18,21,24,29,31,33-36H,2-3,10,12-14,19-20,22H2,1,4-9H3 |
| InChIKey | AFXBWHVQHRYSGA-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.82 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|