C33H48O8 — CID 75971580
[1-acetyloxy-5,10-dihydroxy-3-methoxy-7,8-dimethyl-7-(3-methylidenepent-4-enyl)-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-9-yl] deca-2,4-dienoate (PubChem CID 75971580) has the molecular formula C33H48O8 and a molecular weight of 572.74 g/mol. Its IUPAC name is [1-acetyloxy-5,10-dihydroxy-3-methoxy-7,8-dimethyl-7-(3-methylidenepent-4-enyl)-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-9-yl] deca-2,4-dienoate.
| Compound Name | [1-acetyloxy-5,10-dihydroxy-3-methoxy-7,8-dimethyl-7-(3-methylidenepent-4-enyl)-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-9-yl] deca-2,4-dienoate |
|---|---|
| PubChem CID | 75971580 |
| Molecular Formula | C33H48O8 |
| Molecular Weight | 572.74 g/mol |
| Exact Mass | 572.33 |
| IUPAC Name | [1-acetyloxy-5,10-dihydroxy-3-methoxy-7,8-dimethyl-7-(3-methylidenepent-4-enyl)-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-9-yl] deca-2,4-dienoate |
| SMILES | C=CC(=C)CCC1(C)C(C)C(OC(=O)C=CC=CCCCCC)C(O)C23C(=CC(O)CC12)C(OC)OC3OC(C)=O |
| InChI | InChI=1S/C33H48O8/c1-8-10-11-12-13-14-15-16-27(36)40-28-22(4)32(6,18-17-21(3)9-2)26-20-24(35)19-25-30(38-7)41-31(39-23(5)34)33(25,26)29(28)37/h9,13-16,19,22,24,26,28-31,35,37H,2-3,8,10-12,17-18,20H2,1,4-7H3 |
| InChIKey | IIKQVONZJJQKFU-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.74 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|