C19H18Cl2N4O2 — CID 155569704
N-butyl-2-[(2,3-dichlorobenzoyl)amino]imidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 155569704) has the molecular formula C19H18Cl2N4O2 and a molecular weight of 405.29 g/mol. Its IUPAC name is N-butyl-2-[(2,3-dichlorobenzoyl)amino]imidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | N-butyl-2-[(2,3-dichlorobenzoyl)amino]imidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 155569704 |
| Molecular Formula | C19H18Cl2N4O2 |
| Molecular Weight | 405.29 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | N-butyl-2-[(2,3-dichlorobenzoyl)amino]imidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | CCCCNC(=O)c1c(NC(=O)c2cccc(Cl)c2Cl)nc2ccccn12 |
| InChI | InChI=1S/C19H18Cl2N4O2/c1-2-3-10-22-19(27)16-17(23-14-9-4-5-11-25(14)16)24-18(26)12-7-6-8-13(20)15(12)21/h4-9,11H,2-3,10H2,1H3,(H,22,27)(H,24,26) |
| InChIKey | PMACDMQXKREKDP-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 75.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.29 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|