C17H20Cl2N4O2 — CID 167841225
N-butyl-5-[(2,3-dichlorobenzoyl)amino]-2,3-dimethylimidazole-4-carboxamide (PubChem CID 167841225) has the molecular formula C17H20Cl2N4O2 and a molecular weight of 383.28 g/mol. Its IUPAC name is N-butyl-5-[(2,3-dichlorobenzoyl)amino]-2,3-dimethylimidazole-4-carboxamide.
| Compound Name | N-butyl-5-[(2,3-dichlorobenzoyl)amino]-2,3-dimethylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 167841225 |
| Molecular Formula | C17H20Cl2N4O2 |
| Molecular Weight | 383.28 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | N-butyl-5-[(2,3-dichlorobenzoyl)amino]-2,3-dimethylimidazole-4-carboxamide |
| SMILES | CCCCNC(=O)c1c(NC(=O)c2cccc(Cl)c2Cl)nc(C)n1C |
| InChI | InChI=1S/C17H20Cl2N4O2/c1-4-5-9-20-17(25)14-15(21-10(2)23(14)3)22-16(24)11-7-6-8-12(18)13(11)19/h6-8H,4-5,9H2,1-3H3,(H,20,25)(H,22,24) |
| InChIKey | ZWJBNFZCIMZTSO-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.28 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|