C17H20F4N4O3S — CID 99800605
N-butyl-5-[[4-fluoro-3-(trifluoromethyl)phenyl]sulfonylamino]-2,3-dimethylimidazole-4-carboxamide (PubChem CID 99800605) has the molecular formula C17H20F4N4O3S and a molecular weight of 436.43 g/mol. Its IUPAC name is N-butyl-5-[[4-fluoro-3-(trifluoromethyl)phenyl]sulfonylamino]-2,3-dimethylimidazole-4-carboxamide.
| Compound Name | N-butyl-5-[[4-fluoro-3-(trifluoromethyl)phenyl]sulfonylamino]-2,3-dimethylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 99800605 |
| Molecular Formula | C17H20F4N4O3S |
| Molecular Weight | 436.43 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | N-butyl-5-[[4-fluoro-3-(trifluoromethyl)phenyl]sulfonylamino]-2,3-dimethylimidazole-4-carboxamide |
| SMILES | CCCCNC(=O)c1c(NS(=O)(=O)c2ccc(F)c(C(F)(F)F)c2)nc(C)n1C |
| InChI | InChI=1S/C17H20F4N4O3S/c1-4-5-8-22-16(26)14-15(23-10(2)25(14)3)24-29(27,28)11-6-7-13(18)12(9-11)17(19,20)21/h6-7,9,24H,4-5,8H2,1-3H3,(H,22,26) |
| InChIKey | GQIUBZCJVIWARL-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|