C58H44BF15N4 — CID 155570070
[[1,3-bis[2,6-di(propan-2-yl)phenyl]-2,5-diphenylimidazol-1-ium-4-yl]-diazomethyl]-tris(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 155570070) has the molecular formula C58H44BF15N4 and a molecular weight of 1092.80 g/mol. Its IUPAC name is [[1,3-bis[2,6-di(propan-2-yl)phenyl]-2,5-diphenylimidazol-1-ium-4-yl]-diazomethyl]-tris(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | [[1,3-bis[2,6-di(propan-2-yl)phenyl]-2,5-diphenylimidazol-1-ium-4-yl]-diazomethyl]-tris(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 155570070 |
| Molecular Formula | C58H44BF15N4 |
| Molecular Weight | 1092.80 g/mol |
| Exact Mass | 1092.34 |
| IUPAC Name | [[1,3-bis[2,6-di(propan-2-yl)phenyl]-2,5-diphenylimidazol-1-ium-4-yl]-diazomethyl]-tris(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | CC(C)c1cccc(C(C)C)c1-n1c(C(=[N+]=[N-])[B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(-c2ccccc2)[n+](-c2c(C(C)C)cccc2C(C)C)c1-c1ccccc1 |
| InChI | InChI=1S/C58H44BF15N4/c1-25(2)31-21-15-22-32(26(3)4)54(31)77-53(29-17-11-9-12-18-29)56(78(58(77)30-19-13-10-14-20-30)55-33(27(5)6)23-16-24-34(55)28(7)8)57(76-75)59(35-38(60)44(66)50(72)45(67)39(35)61,36-40(62)46(68)51(73)47(69)41(36)63)37-42(64)48(70)52(74)49(71)43(37)65/h9-28H,1-8H3 |
| InChIKey | INHUXPONDOCYGO-UHFFFAOYSA-N |
| XLogP | 14.40 |
| TPSA | 45.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1092.80 |
| LogP ≤ 5 | 14.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|