C28H41NS — CID 155576202
2-[2-methyl-3-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-6-pentylphenyl]sulfanyl-2-azaspiro[3.3]heptane (PubChem CID 155576202) has the molecular formula C28H41NS and a molecular weight of 423.71 g/mol. Its IUPAC name is 2-[2-methyl-3-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-6-pentylphenyl]sulfanyl-2-azaspiro[3.3]heptane.
| Compound Name | 2-[2-methyl-3-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-6-pentylphenyl]sulfanyl-2-azaspiro[3.3]heptane |
|---|---|
| PubChem CID | 155576202 |
| Molecular Formula | C28H41NS |
| Molecular Weight | 423.71 g/mol |
| Exact Mass | 423.30 |
| IUPAC Name | 2-[2-methyl-3-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-6-pentylphenyl]sulfanyl-2-azaspiro[3.3]heptane |
| SMILES | C=C(C)C1CCC(C)=CC1c1ccc(CCCCC)c(SN2CC3(CCC3)C2)c1C |
| InChI | InChI=1S/C28H41NS/c1-6-7-8-10-23-12-14-25(26-17-21(4)11-13-24(26)20(2)3)22(5)27(23)30-29-18-28(19-29)15-9-16-28/h12,14,17,24,26H,2,6-11,13,15-16,18-19H2,1,3-5H3 |
| InChIKey | VMFBHOGQIBJQAQ-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.71 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|