C24H32N2O3S — CID 155577713
acetamide;2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylamino)sulfanyl-5,5-dimethyl-3a,6,7,7a-tetrahydro-1-benzofuran-4-one (PubChem CID 155577713) has the molecular formula C24H32N2O3S and a molecular weight of 428.60 g/mol. Its IUPAC name is acetamide;2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylamino)sulfanyl-5,5-dimethyl-3a,6,7,7a-tetrahydro-1-benzofuran-4-one.
| Compound Name | acetamide;2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylamino)sulfanyl-5,5-dimethyl-3a,6,7,7a-tetrahydro-1-benzofuran-4-one |
|---|---|
| PubChem CID | 155577713 |
| Molecular Formula | C24H32N2O3S |
| Molecular Weight | 428.60 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | acetamide;2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylamino)sulfanyl-5,5-dimethyl-3a,6,7,7a-tetrahydro-1-benzofuran-4-one |
| SMILES | CC(N)=O.CC1(C)CCC2OC(SNc3c4c(cc5c3CCC5)CCC4)=CC2C1=O |
| InChI | InChI=1S/C22H27NO2S.C2H5NO/c1-22(2)10-9-18-17(21(22)24)12-19(25-18)26-23-20-15-7-3-5-13(15)11-14-6-4-8-16(14)20;1-2(3)4/h11-12,17-18,23H,3-10H2,1-2H3;1H3,(H2,3,4) |
| InChIKey | NUAGWTPDKSTMQA-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.60 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|