C22H28N2O3S — CID 155577737
acetamide;2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylamino)sulfanyl-4,5,6,7-tetrahydro-1-benzofuran-4-ol (PubChem CID 155577737) has the molecular formula C22H28N2O3S and a molecular weight of 400.54 g/mol. Its IUPAC name is acetamide;2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylamino)sulfanyl-4,5,6,7-tetrahydro-1-benzofuran-4-ol.
| Compound Name | acetamide;2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylamino)sulfanyl-4,5,6,7-tetrahydro-1-benzofuran-4-ol |
|---|---|
| PubChem CID | 155577737 |
| Molecular Formula | C22H28N2O3S |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | acetamide;2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylamino)sulfanyl-4,5,6,7-tetrahydro-1-benzofuran-4-ol |
| SMILES | CC(N)=O.OC1CCCc2oc(SNc3c4c(cc5c3CCC5)CCC4)cc21 |
| InChI | InChI=1S/C20H23NO2S.C2H5NO/c22-17-8-3-9-18-16(17)11-19(23-18)24-21-20-14-6-1-4-12(14)10-13-5-2-7-15(13)20;1-2(3)4/h10-11,17,21-22H,1-9H2;1H3,(H2,3,4) |
| InChIKey | MXVNZVUDYWYUCZ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|