C25H31ClN2O3S — CID 155578102
1-(8-chloro-1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[5-[3-(2-hydroxypropan-2-yl)cyclopentyl]furan-2-yl]sulfanylurea (PubChem CID 155578102) has the molecular formula C25H31ClN2O3S and a molecular weight of 475.05 g/mol. Its IUPAC name is 1-(8-chloro-1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[5-[3-(2-hydroxypropan-2-yl)cyclopentyl]furan-2-yl]sulfanylurea.
| Compound Name | 1-(8-chloro-1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[5-[3-(2-hydroxypropan-2-yl)cyclopentyl]furan-2-yl]sulfanylurea |
|---|---|
| PubChem CID | 155578102 |
| Molecular Formula | C25H31ClN2O3S |
| Molecular Weight | 475.05 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | 1-(8-chloro-1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[5-[3-(2-hydroxypropan-2-yl)cyclopentyl]furan-2-yl]sulfanylurea |
| SMILES | CC(C)(O)C1CCC(c2ccc(SNC(=O)Nc3c4c(c(Cl)c5c3CCC5)CCC4)o2)C1 |
| InChI | InChI=1S/C25H31ClN2O3S/c1-25(2,30)15-10-9-14(13-15)20-11-12-21(31-20)32-28-24(29)27-23-18-7-3-5-16(18)22(26)17-6-4-8-19(17)23/h11-12,14-15,30H,3-10,13H2,1-2H3,(H2,27,28,29) |
| InChIKey | LFRFNDKDMJABIX-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.05 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|