C20H16F5NO5S — CID 155578497
2,3,4,5-tetrafluoro-N-(3-fluoro-4-methoxyphenyl)-6-(oxetan-3-ylmethoxy)-N-prop-2-ynylbenzenesulfonamide (PubChem CID 155578497) has the molecular formula C20H16F5NO5S and a molecular weight of 477.41 g/mol. Its IUPAC name is 2,3,4,5-tetrafluoro-N-(3-fluoro-4-methoxyphenyl)-6-(oxetan-3-ylmethoxy)-N-prop-2-ynylbenzenesulfonamide.
| Compound Name | 2,3,4,5-tetrafluoro-N-(3-fluoro-4-methoxyphenyl)-6-(oxetan-3-ylmethoxy)-N-prop-2-ynylbenzenesulfonamide |
|---|---|
| PubChem CID | 155578497 |
| Molecular Formula | C20H16F5NO5S |
| Molecular Weight | 477.41 g/mol |
| Exact Mass | 477.07 |
| IUPAC Name | 2,3,4,5-tetrafluoro-N-(3-fluoro-4-methoxyphenyl)-6-(oxetan-3-ylmethoxy)-N-prop-2-ynylbenzenesulfonamide |
| SMILES | C#CCN(c1ccc(OC)c(F)c1)S(=O)(=O)c1c(F)c(F)c(F)c(F)c1OCC1COC1 |
| InChI | InChI=1S/C20H16F5NO5S/c1-3-6-26(12-4-5-14(29-2)13(21)7-12)32(27,28)20-18(25)16(23)15(22)17(24)19(20)31-10-11-8-30-9-11/h1,4-5,7,11H,6,8-10H2,2H3 |
| InChIKey | BAKBZAPVCALCJE-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.41 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|