C6H5IN4S — CID 155582014
2-[3-(methylamino)-1,2,4-triazin-6-yl]ethynyl thiohypoiodite (PubChem CID 155582014) has the molecular formula C6H5IN4S and a molecular weight of 292.11 g/mol. Its IUPAC name is 2-[3-(methylamino)-1,2,4-triazin-6-yl]ethynyl thiohypoiodite.
| Compound Name | 2-[3-(methylamino)-1,2,4-triazin-6-yl]ethynyl thiohypoiodite |
|---|---|
| PubChem CID | 155582014 |
| Molecular Formula | C6H5IN4S |
| Molecular Weight | 292.11 g/mol |
| Exact Mass | 291.93 |
| IUPAC Name | 2-[3-(methylamino)-1,2,4-triazin-6-yl]ethynyl thiohypoiodite |
| SMILES | CNc1ncc(C#CSI)nn1 |
| InChI | InChI=1S/C6H5IN4S/c1-8-6-9-4-5(10-11-6)2-3-12-7/h4H,1H3,(H,8,9,11) |
| InChIKey | BSOACVTWZJJISS-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.11 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|