C13H20N4 — CID 155591722
(4S)-2-pyridin-2-yl-2,8-diazaspiro[4.5]decan-4-amine (PubChem CID 155591722) has the molecular formula C13H20N4 and a molecular weight of 232.33 g/mol. Its IUPAC name is (4S)-2-pyridin-2-yl-2,8-diazaspiro[4.5]decan-4-amine.
| Compound Name | (4S)-2-pyridin-2-yl-2,8-diazaspiro[4.5]decan-4-amine |
|---|---|
| PubChem CID | 155591722 |
| Molecular Formula | C13H20N4 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | (4S)-2-pyridin-2-yl-2,8-diazaspiro[4.5]decan-4-amine |
| SMILES | N[C@@H]1CN(c2ccccn2)CC12CCNCC2 |
| InChI | InChI=1S/C13H20N4/c14-11-9-17(12-3-1-2-6-16-12)10-13(11)4-7-15-8-5-13/h1-3,6,11,15H,4-5,7-10,14H2/t11-/m1/s1 |
| InChIKey | UNCNVOJWGMGBLG-LLVKDONJSA-N |
| XLogP | 0.60 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |