C12H16Cl2N2OS — CID 155595774
7-piperidin-4-yloxythieno[3,2-b]pyridine;dihydrochloride (PubChem CID 155595774) has the molecular formula C12H16Cl2N2OS and a molecular weight of 307.25 g/mol. Its IUPAC name is 7-piperidin-4-yloxythieno[3,2-b]pyridine;dihydrochloride.
| Compound Name | 7-piperidin-4-yloxythieno[3,2-b]pyridine;dihydrochloride |
|---|---|
| PubChem CID | 155595774 |
| Molecular Formula | C12H16Cl2N2OS |
| Molecular Weight | 307.25 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | 7-piperidin-4-yloxythieno[3,2-b]pyridine;dihydrochloride |
| SMILES | Cl.Cl.c1cc(OC2CCNCC2)c2sccc2n1 |
| InChI | InChI=1S/C12H14N2OS.2ClH/c1-5-13-6-2-9(1)15-11-3-7-14-10-4-8-16-12(10)11;;/h3-4,7-9,13H,1-2,5-6H2;2*1H |
| InChIKey | DCQCOCHSXVVXFM-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.25 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |