C14H11BrF3NO6S2 — CID 155598050
5-bromo-2-hydroxy-N-(3-methylsulfonylphenyl)-3-(trifluoromethoxy)benzenesulfonamide (PubChem CID 155598050) has the molecular formula C14H11BrF3NO6S2 and a molecular weight of 490.28 g/mol. Its IUPAC name is 5-bromo-2-hydroxy-N-(3-methylsulfonylphenyl)-3-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | 5-bromo-2-hydroxy-N-(3-methylsulfonylphenyl)-3-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 155598050 |
| Molecular Formula | C14H11BrF3NO6S2 |
| Molecular Weight | 490.28 g/mol |
| Exact Mass | 488.92 |
| IUPAC Name | 5-bromo-2-hydroxy-N-(3-methylsulfonylphenyl)-3-(trifluoromethoxy)benzenesulfonamide |
| SMILES | CS(=O)(=O)c1cccc(NS(=O)(=O)c2cc(Br)cc(OC(F)(F)F)c2O)c1 |
| InChI | InChI=1S/C14H11BrF3NO6S2/c1-26(21,22)10-4-2-3-9(7-10)19-27(23,24)12-6-8(15)5-11(13(12)20)25-14(16,17)18/h2-7,19-20H,1H3 |
| InChIKey | LQCDXOZHSSDGTP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.28 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |