C16H18N2O2 — CID 155598161
4-(3,4-dimethoxyphenyl)-1,2,3,4-tetrahydro-2,7-naphthyridine (PubChem CID 155598161) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)-1,2,3,4-tetrahydro-2,7-naphthyridine.
| Compound Name | 4-(3,4-dimethoxyphenyl)-1,2,3,4-tetrahydro-2,7-naphthyridine |
|---|---|
| PubChem CID | 155598161 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)-1,2,3,4-tetrahydro-2,7-naphthyridine |
| SMILES | COc1ccc(C2CNCc3cnccc32)cc1OC |
| InChI | InChI=1S/C16H18N2O2/c1-19-15-4-3-11(7-16(15)20-2)14-10-18-9-12-8-17-6-5-13(12)14/h3-8,14,18H,9-10H2,1-2H3 |
| InChIKey | JXYWMAWQHDYPFC-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |