C30H19F11IrN- — CID 155602182
2-[3-[2-(2,6-dimethylphenyl)-4-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)phenyl]benzene-6-id-1-yl]pyridine;iridium (PubChem CID 155602182) has the molecular formula C30H19F11IrN- and a molecular weight of 794.68 g/mol. Its IUPAC name is 2-[3-[2-(2,6-dimethylphenyl)-4-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)phenyl]benzene-6-id-1-yl]pyridine;iridium.
| Compound Name | 2-[3-[2-(2,6-dimethylphenyl)-4-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)phenyl]benzene-6-id-1-yl]pyridine;iridium |
|---|---|
| PubChem CID | 155602182 |
| Molecular Formula | C30H19F11IrN- |
| Molecular Weight | 794.68 g/mol |
| Exact Mass | 795.10 |
| IUPAC Name | 2-[3-[2-(2,6-dimethylphenyl)-4-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)phenyl]benzene-6-id-1-yl]pyridine;iridium |
| SMILES | Cc1cccc(C)c1-c1cc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)ccc1-c1cc[c-]c(-c2ccccn2)c1.[Ir] |
| InChI | InChI=1S/C30H19F11N.Ir/c1-17-7-5-8-18(2)25(17)23-16-21(26(31,32)27(33,34)28(35,36)29(37,38)30(39,40)41)12-13-22(23)19-9-6-10-20(15-19)24-11-3-4-14-42-24;/h3-9,11-16H,1-2H3;/q-1; |
| InChIKey | CFYVWCLQTQDIPS-UHFFFAOYSA-N |
| XLogP | 10.06 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.68 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|