C52H34N4O2Pt — CID 155610047
3-carbazol-9-yl-8-[[6-(4-carbazol-9-yl-2-hydroxyphenyl)-4-phenyl-2-pyridinyl]methylideneamino]naphthalen-1-ol;platinum (PubChem CID 155610047) has the molecular formula C52H34N4O2Pt and a molecular weight of 941.95 g/mol. Its IUPAC name is 3-carbazol-9-yl-8-[[6-(4-carbazol-9-yl-2-hydroxyphenyl)-4-phenyl-2-pyridinyl]methylideneamino]naphthalen-1-ol;platinum.
| Compound Name | 3-carbazol-9-yl-8-[[6-(4-carbazol-9-yl-2-hydroxyphenyl)-4-phenyl-2-pyridinyl]methylideneamino]naphthalen-1-ol;platinum |
|---|---|
| PubChem CID | 155610047 |
| Molecular Formula | C52H34N4O2Pt |
| Molecular Weight | 941.95 g/mol |
| Exact Mass | 941.23 |
| IUPAC Name | 3-carbazol-9-yl-8-[[6-(4-carbazol-9-yl-2-hydroxyphenyl)-4-phenyl-2-pyridinyl]methylideneamino]naphthalen-1-ol;platinum |
| SMILES | Oc1cc(-n2c3ccccc3c3ccccc32)ccc1-c1cc(-c2ccccc2)cc(/C=N/c2cccc3cc(-n4c5ccccc5c5ccccc54)cc(O)c23)n1.[Pt] |
| InChI | InChI=1S/C52H34N4O2.Pt/c57-50-30-37(55-46-21-8-4-16-39(46)40-17-5-9-22-47(40)55)25-26-43(50)45-29-35(33-13-2-1-3-14-33)27-36(54-45)32-53-44-20-12-15-34-28-38(31-51(58)52(34)44)56-48-23-10-6-18-41(48)42-19-7-11-24-49(42)56;/h1-32,57-58H;/b53-32+; |
| InChIKey | HTOLSCOGZREGRL-IAAMJLBESA-N |
| XLogP | 12.92 |
| TPSA | 75.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 941.95 |
| LogP ≤ 5 | 12.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|