C19H14Cl2N2 — CID 155613055
4-[(2,6-dichlorophenyl)-(4-iminocyclohexa-2,5-dien-1-ylidene)methyl]aniline (PubChem CID 155613055) has the molecular formula C19H14Cl2N2 and a molecular weight of 341.24 g/mol. Its IUPAC name is 4-[(2,6-dichlorophenyl)-(4-iminocyclohexa-2,5-dien-1-ylidene)methyl]aniline.
| Compound Name | 4-[(2,6-dichlorophenyl)-(4-iminocyclohexa-2,5-dien-1-ylidene)methyl]aniline |
|---|---|
| PubChem CID | 155613055 |
| Molecular Formula | C19H14Cl2N2 |
| Molecular Weight | 341.24 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | 4-[(2,6-dichlorophenyl)-(4-iminocyclohexa-2,5-dien-1-ylidene)methyl]aniline |
| SMILES | [H]N=C1C=CC(=C(c2ccc(N)cc2)c2c(Cl)cccc2Cl)C=C1 |
| InChI | InChI=1S/C19H14Cl2N2/c20-16-2-1-3-17(21)19(16)18(12-4-8-14(22)9-5-12)13-6-10-15(23)11-7-13/h1-11,22H,23H2/b18-12-,22-14+ |
| InChIKey | CJFAFIKCBXZRSC-CXLYJZFPSA-N |
| XLogP | 5.52 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.24 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|