C27H30Cl2N2 — CID 59773696
4-[(2,6-dichlorophenyl)-(3,5-diethyl-4-iminocyclohexa-2,5-dien-1-ylidene)methyl]-2,6-diethylaniline (PubChem CID 59773696) has the molecular formula C27H30Cl2N2 and a molecular weight of 453.46 g/mol. Its IUPAC name is 4-[(2,6-dichlorophenyl)-(3,5-diethyl-4-iminocyclohexa-2,5-dien-1-ylidene)methyl]-2,6-diethylaniline.
| Compound Name | 4-[(2,6-dichlorophenyl)-(3,5-diethyl-4-iminocyclohexa-2,5-dien-1-ylidene)methyl]-2,6-diethylaniline |
|---|---|
| PubChem CID | 59773696 |
| Molecular Formula | C27H30Cl2N2 |
| Molecular Weight | 453.46 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | 4-[(2,6-dichlorophenyl)-(3,5-diethyl-4-iminocyclohexa-2,5-dien-1-ylidene)methyl]-2,6-diethylaniline |
| SMILES | [H]N=C1C(CC)=CC(=C(c2cc(CC)c(N)c(CC)c2)c2c(Cl)cccc2Cl)C=C1CC |
| InChI | InChI=1S/C27H30Cl2N2/c1-5-16-12-20(13-17(6-2)26(16)30)24(25-22(28)10-9-11-23(25)29)21-14-18(7-3)27(31)19(8-4)15-21/h9-15,30H,5-8,31H2,1-4H3/b24-20-,30-26- |
| InChIKey | NHJZEWFUZLVZHA-NOWBBRIRSA-N |
| XLogP | 8.21 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.46 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|