C33H50FN5O5 — CID 155618884
tert-butyl (NZ)-N-[[(2S)-2-[3-(3-fluoro-4-nonylphenyl)-6H-1,2,4-oxadiazin-5-yl]pyrrolidin-1-yl]-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate (PubChem CID 155618884) has the molecular formula C33H50FN5O5 and a molecular weight of 615.79 g/mol. Its IUPAC name is tert-butyl (NZ)-N-[[(2S)-2-[3-(3-fluoro-4-nonylphenyl)-6H-1,2,4-oxadiazin-5-yl]pyrrolidin-1-yl]-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate.
| Compound Name | tert-butyl (NZ)-N-[[(2S)-2-[3-(3-fluoro-4-nonylphenyl)-6H-1,2,4-oxadiazin-5-yl]pyrrolidin-1-yl]-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate |
|---|---|
| PubChem CID | 155618884 |
| Molecular Formula | C33H50FN5O5 |
| Molecular Weight | 615.79 g/mol |
| Exact Mass | 615.38 |
| IUPAC Name | tert-butyl (NZ)-N-[[(2S)-2-[3-(3-fluoro-4-nonylphenyl)-6H-1,2,4-oxadiazin-5-yl]pyrrolidin-1-yl]-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate |
| SMILES | CCCCCCCCCc1ccc(C2=NOCC([C@@H]3CCCN3/C(=N\C(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)=N2)cc1F |
| InChI | InChI=1S/C33H50FN5O5/c1-8-9-10-11-12-13-14-16-23-18-19-24(21-25(23)34)28-35-26(22-42-38-28)27-17-15-20-39(27)29(36-30(40)43-32(2,3)4)37-31(41)44-33(5,6)7/h18-19,21,27H,8-17,20,22H2,1-7H3,(H,36,37,40,41)/t27-/m0/s1 |
| InChIKey | YUEADRUDZJBPLJ-MHZLTWQESA-N |
| XLogP | 7.53 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.79 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|