C33H51N5O5 — CID 161385953
tert-butyl N-[[(2S)-2-[3-(3-methyl-4-octylphenyl)-6H-1,2,4-oxadiazin-5-yl]pyrrolidin-1-yl]-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate (PubChem CID 161385953) has the molecular formula C33H51N5O5 and a molecular weight of 597.80 g/mol. Its IUPAC name is tert-butyl N-[[(2S)-2-[3-(3-methyl-4-octylphenyl)-6H-1,2,4-oxadiazin-5-yl]pyrrolidin-1-yl]-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate.
| Compound Name | tert-butyl N-[[(2S)-2-[3-(3-methyl-4-octylphenyl)-6H-1,2,4-oxadiazin-5-yl]pyrrolidin-1-yl]-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate |
|---|---|
| PubChem CID | 161385953 |
| Molecular Formula | C33H51N5O5 |
| Molecular Weight | 597.80 g/mol |
| Exact Mass | 597.39 |
| IUPAC Name | tert-butyl N-[[(2S)-2-[3-(3-methyl-4-octylphenyl)-6H-1,2,4-oxadiazin-5-yl]pyrrolidin-1-yl]-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate |
| SMILES | CCCCCCCCc1ccc(C2=NOCC([C@@H]3CCCN3C(=NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)=N2)cc1C |
| InChI | InChI=1S/C33H51N5O5/c1-9-10-11-12-13-14-16-24-18-19-25(21-23(24)2)28-34-26(22-41-37-28)27-17-15-20-38(27)29(35-30(39)42-32(3,4)5)36-31(40)43-33(6,7)8/h18-19,21,27H,9-17,20,22H2,1-8H3,(H,35,36,39,40)/t27-/m0/s1 |
| InChIKey | VSIRWUQITGZUEA-MHZLTWQESA-N |
| XLogP | 7.31 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.80 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|