C27H41N3O3 — CID 161393484
tert-butyl (2S)-2-[3-(3-methyl-4-octylphenyl)-6H-1,2,4-oxadiazin-5-yl]pyrrolidine-1-carboxylate (PubChem CID 161393484) has the molecular formula C27H41N3O3 and a molecular weight of 455.64 g/mol. Its IUPAC name is tert-butyl (2S)-2-[3-(3-methyl-4-octylphenyl)-6H-1,2,4-oxadiazin-5-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[3-(3-methyl-4-octylphenyl)-6H-1,2,4-oxadiazin-5-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 161393484 |
| Molecular Formula | C27H41N3O3 |
| Molecular Weight | 455.64 g/mol |
| Exact Mass | 455.31 |
| IUPAC Name | tert-butyl (2S)-2-[3-(3-methyl-4-octylphenyl)-6H-1,2,4-oxadiazin-5-yl]pyrrolidine-1-carboxylate |
| SMILES | CCCCCCCCc1ccc(C2=NOCC([C@@H]3CCCN3C(=O)OC(C)(C)C)=N2)cc1C |
| InChI | InChI=1S/C27H41N3O3/c1-6-7-8-9-10-11-13-21-15-16-22(18-20(21)2)25-28-23(19-32-29-25)24-14-12-17-30(24)26(31)33-27(3,4)5/h15-16,18,24H,6-14,17,19H2,1-5H3/t24-/m0/s1 |
| InChIKey | VTHHWCKDNRCNFH-DEOSSOPVSA-N |
| XLogP | 6.43 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.64 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|