C22H33N3O — CID 158284586
3-(3-methyl-4-octylphenyl)-5-[(2S)-pyrrolidin-2-yl]-6H-1,2,4-oxadiazine (PubChem CID 158284586) has the molecular formula C22H33N3O and a molecular weight of 355.53 g/mol. Its IUPAC name is 3-(3-methyl-4-octylphenyl)-5-[(2S)-pyrrolidin-2-yl]-6H-1,2,4-oxadiazine.
| Compound Name | 3-(3-methyl-4-octylphenyl)-5-[(2S)-pyrrolidin-2-yl]-6H-1,2,4-oxadiazine |
|---|---|
| PubChem CID | 158284586 |
| Molecular Formula | C22H33N3O |
| Molecular Weight | 355.53 g/mol |
| Exact Mass | 355.26 |
| IUPAC Name | 3-(3-methyl-4-octylphenyl)-5-[(2S)-pyrrolidin-2-yl]-6H-1,2,4-oxadiazine |
| SMILES | CCCCCCCCc1ccc(C2=NOCC([C@@H]3CCCN3)=N2)cc1C |
| InChI | InChI=1S/C22H33N3O/c1-3-4-5-6-7-8-10-18-12-13-19(15-17(18)2)22-24-21(16-26-25-22)20-11-9-14-23-20/h12-13,15,20,23H,3-11,14,16H2,1-2H3/t20-/m0/s1 |
| InChIKey | GKPVISYKWVPPHH-FQEVSTJZSA-N |
| XLogP | 4.78 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.53 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|