C23H34FN5O — CID 155618890
(2S)-2-[3-(3-fluoro-4-nonylphenyl)-6H-1,2,4-oxadiazin-5-yl]pyrrolidine-1-carboximidamide (PubChem CID 155618890) has the molecular formula C23H34FN5O and a molecular weight of 415.56 g/mol. Its IUPAC name is (2S)-2-[3-(3-fluoro-4-nonylphenyl)-6H-1,2,4-oxadiazin-5-yl]pyrrolidine-1-carboximidamide.
| Compound Name | (2S)-2-[3-(3-fluoro-4-nonylphenyl)-6H-1,2,4-oxadiazin-5-yl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 155618890 |
| Molecular Formula | C23H34FN5O |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.27 |
| IUPAC Name | (2S)-2-[3-(3-fluoro-4-nonylphenyl)-6H-1,2,4-oxadiazin-5-yl]pyrrolidine-1-carboximidamide |
| SMILES | [H]/N=C(\N)N1CCC[C@H]1C1=NC(c2ccc(CCCCCCCCC)c(F)c2)=NOC1 |
| InChI | InChI=1S/C23H34FN5O/c1-2-3-4-5-6-7-8-10-17-12-13-18(15-19(17)24)22-27-20(16-30-28-22)21-11-9-14-29(21)23(25)26/h12-13,15,21H,2-11,14,16H2,1H3,(H3,25,26)/t21-/m0/s1 |
| InChIKey | RNHHMFBZWYBOGG-NRFANRHFSA-N |
| XLogP | 4.61 |
| TPSA | 87.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|