C27H40FN3O3 — CID 155618889
tert-butyl (2S)-2-[3-(3-fluoro-4-nonylphenyl)-6H-1,2,4-oxadiazin-5-yl]pyrrolidine-1-carboxylate (PubChem CID 155618889) has the molecular formula C27H40FN3O3 and a molecular weight of 473.63 g/mol. Its IUPAC name is tert-butyl (2S)-2-[3-(3-fluoro-4-nonylphenyl)-6H-1,2,4-oxadiazin-5-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[3-(3-fluoro-4-nonylphenyl)-6H-1,2,4-oxadiazin-5-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 155618889 |
| Molecular Formula | C27H40FN3O3 |
| Molecular Weight | 473.63 g/mol |
| Exact Mass | 473.31 |
| IUPAC Name | tert-butyl (2S)-2-[3-(3-fluoro-4-nonylphenyl)-6H-1,2,4-oxadiazin-5-yl]pyrrolidine-1-carboxylate |
| SMILES | CCCCCCCCCc1ccc(C2=NOCC([C@@H]3CCCN3C(=O)OC(C)(C)C)=N2)cc1F |
| InChI | InChI=1S/C27H40FN3O3/c1-5-6-7-8-9-10-11-13-20-15-16-21(18-22(20)28)25-29-23(19-33-30-25)24-14-12-17-31(24)26(32)34-27(2,3)4/h15-16,18,24H,5-14,17,19H2,1-4H3/t24-/m0/s1 |
| InChIKey | FEOPJFKIZPZVLR-DEOSSOPVSA-N |
| XLogP | 6.65 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.63 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|