C17H26N4O — CID 141127979
N-[2-(diethylamino)ethyl]-4-(4,5-dihydro-1,2-oxazol-3-yl)-N-methylbenzenecarboximidamide (PubChem CID 141127979) has the molecular formula C17H26N4O and a molecular weight of 302.42 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-4-(4,5-dihydro-1,2-oxazol-3-yl)-N-methylbenzenecarboximidamide.
| Compound Name | N-[2-(diethylamino)ethyl]-4-(4,5-dihydro-1,2-oxazol-3-yl)-N-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 141127979 |
| Molecular Formula | C17H26N4O |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-4-(4,5-dihydro-1,2-oxazol-3-yl)-N-methylbenzenecarboximidamide |
| SMILES | [H]/N=C(/c1ccc(C2=NOCC2)cc1)N(C)CCN(CC)CC |
| InChI | InChI=1S/C17H26N4O/c1-4-21(5-2)12-11-20(3)17(18)15-8-6-14(7-9-15)16-10-13-22-19-16/h6-9,18H,4-5,10-13H2,1-3H3/b18-17- |
| InChIKey | MNOLZKOPJUTWPA-ZCXUNETKSA-N |
| XLogP | 2.41 |
| TPSA | 51.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|