C14H10N4 — CID 155635456
2-(3-isocyanophenyl)-8-methyl-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 155635456) has the molecular formula C14H10N4 and a molecular weight of 234.26 g/mol. Its IUPAC name is 2-(3-isocyanophenyl)-8-methyl-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 2-(3-isocyanophenyl)-8-methyl-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 155635456 |
| Molecular Formula | C14H10N4 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 2-(3-isocyanophenyl)-8-methyl-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | [C-]#[N+]c1cccc(-c2nc3c(C)cccn3n2)c1 |
| InChI | InChI=1S/C14H10N4/c1-10-5-4-8-18-14(10)16-13(17-18)11-6-3-7-12(9-11)15-2/h3-9H,1H3 |
| InChIKey | YPCJANQQLNDJKV-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 34.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|