C23H17N5OS — CID 155654666
3-cyano-N-[4-[3-(4-isocyanoanilino)phenyl]-1,3-thiazol-2-yl]bicyclo[1.1.1]pentane-1-carboxamide (PubChem CID 155654666) has the molecular formula C23H17N5OS and a molecular weight of 411.49 g/mol. Its IUPAC name is 3-cyano-N-[4-[3-(4-isocyanoanilino)phenyl]-1,3-thiazol-2-yl]bicyclo[1.1.1]pentane-1-carboxamide.
| Compound Name | 3-cyano-N-[4-[3-(4-isocyanoanilino)phenyl]-1,3-thiazol-2-yl]bicyclo[1.1.1]pentane-1-carboxamide |
|---|---|
| PubChem CID | 155654666 |
| Molecular Formula | C23H17N5OS |
| Molecular Weight | 411.49 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | 3-cyano-N-[4-[3-(4-isocyanoanilino)phenyl]-1,3-thiazol-2-yl]bicyclo[1.1.1]pentane-1-carboxamide |
| SMILES | [C-]#[N+]c1ccc(Nc2cccc(-c3csc(NC(=O)C45CC(C#N)(C4)C5)n3)c2)cc1 |
| InChI | InChI=1S/C23H17N5OS/c1-25-16-5-7-17(8-6-16)26-18-4-2-3-15(9-18)19-10-30-21(27-19)28-20(29)23-11-22(12-23,13-23)14-24/h2-10,26H,11-13H2,(H,27,28,29) |
| InChIKey | PVFXLTVMLVNFQR-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.49 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|