C39H53N7O10S4 — CID 155657050
tert-butyl N-[(5S)-5,6-bis[[1-butoxy-6-oxo-5-(2-sulfanylidene-1,3-thiazolidine-3-carbonyl)pyridine-2-carbonyl]amino]hexyl]carbamate (PubChem CID 155657050) has the molecular formula C39H53N7O10S4 and a molecular weight of 908.16 g/mol. Its IUPAC name is tert-butyl N-[(5S)-5,6-bis[[1-butoxy-6-oxo-5-(2-sulfanylidene-1,3-thiazolidine-3-carbonyl)pyridine-2-carbonyl]amino]hexyl]carbamate.
| Compound Name | tert-butyl N-[(5S)-5,6-bis[[1-butoxy-6-oxo-5-(2-sulfanylidene-1,3-thiazolidine-3-carbonyl)pyridine-2-carbonyl]amino]hexyl]carbamate |
|---|---|
| PubChem CID | 155657050 |
| Molecular Formula | C39H53N7O10S4 |
| Molecular Weight | 908.16 g/mol |
| Exact Mass | 907.27 |
| IUPAC Name | tert-butyl N-[(5S)-5,6-bis[[1-butoxy-6-oxo-5-(2-sulfanylidene-1,3-thiazolidine-3-carbonyl)pyridine-2-carbonyl]amino]hexyl]carbamate |
| SMILES | CCCCOn1c(C(=O)NC[C@H](CCCCNC(=O)OC(C)(C)C)NC(=O)c2ccc(C(=O)N3CCSC3=S)c(=O)n2OCCCC)ccc(C(=O)N2CCSC2=S)c1=O |
| InChI | InChI=1S/C39H53N7O10S4/c1-6-8-20-54-45-28(15-13-26(34(45)51)32(49)43-18-22-59-37(43)57)30(47)41-24-25(12-10-11-17-40-36(53)56-39(3,4)5)42-31(48)29-16-14-27(33(50)44-19-23-60-38(44)58)35(52)46(29)55-21-9-7-2/h13-16,25H,6-12,17-24H2,1-5H3,(H,40,53)(H,41,47)(H,42,48)/t25-/m0/s1 |
| InChIKey | NTSBHTFSYMUXBF-VWLOTQADSA-N |
| XLogP | 3.64 |
| TPSA | 199.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 908.16 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|