C11H11F9O2 — CID 155658037
ethyl 2-methyl-3-(1,2,2,3,3,4,4,5,5-nonafluorocyclopentyl)propanoate (PubChem CID 155658037) has the molecular formula C11H11F9O2 and a molecular weight of 346.19 g/mol. Its IUPAC name is ethyl 2-methyl-3-(1,2,2,3,3,4,4,5,5-nonafluorocyclopentyl)propanoate.
| Compound Name | ethyl 2-methyl-3-(1,2,2,3,3,4,4,5,5-nonafluorocyclopentyl)propanoate |
|---|---|
| PubChem CID | 155658037 |
| Molecular Formula | C11H11F9O2 |
| Molecular Weight | 346.19 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | ethyl 2-methyl-3-(1,2,2,3,3,4,4,5,5-nonafluorocyclopentyl)propanoate |
| SMILES | CCOC(=O)C(C)CC1(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C11H11F9O2/c1-3-22-6(21)5(2)4-7(12)8(13,14)10(17,18)11(19,20)9(7,15)16/h5H,3-4H2,1-2H3 |
| InChIKey | BJHDNQSINPQCBJ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.19 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|