C8H10N4 — CID 155660949
1,2-dihydropyrrolo[1,2-a]pyrazine-6-carboximidamide (PubChem CID 155660949) has the molecular formula C8H10N4 and a molecular weight of 162.20 g/mol. Its IUPAC name is 1,2-dihydropyrrolo[1,2-a]pyrazine-6-carboximidamide.
| Compound Name | 1,2-dihydropyrrolo[1,2-a]pyrazine-6-carboximidamide |
|---|---|
| PubChem CID | 155660949 |
| Molecular Formula | C8H10N4 |
| Molecular Weight | 162.20 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 1,2-dihydropyrrolo[1,2-a]pyrazine-6-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc2n1C=CNC2 |
| InChI | InChI=1S/C8H10N4/c9-8(10)7-2-1-6-5-11-3-4-12(6)7/h1-4,11H,5H2,(H3,9,10) |
| InChIKey | LXMJZQBDAWKLES-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 66.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.20 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|