C9H14N2O8S — CID 155662673
hydrogen sulfate;2-(1H-imidazol-3-ium-3-yl)-4-methylpentanedioic acid (PubChem CID 155662673) has the molecular formula C9H14N2O8S and a molecular weight of 310.28 g/mol. Its IUPAC name is hydrogen sulfate;2-(1H-imidazol-3-ium-3-yl)-4-methylpentanedioic acid.
| Compound Name | hydrogen sulfate;2-(1H-imidazol-3-ium-3-yl)-4-methylpentanedioic acid |
|---|---|
| PubChem CID | 155662673 |
| Molecular Formula | C9H14N2O8S |
| Molecular Weight | 310.28 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | hydrogen sulfate;2-(1H-imidazol-3-ium-3-yl)-4-methylpentanedioic acid |
| SMILES | CC(CC(C(=O)O)[n+]1cc[nH]c1)C(=O)O.O=S(=O)([O-])O |
| InChI | InChI=1S/C9H12N2O4.H2O4S/c1-6(8(12)13)4-7(9(14)15)11-3-2-10-5-11;1-5(2,3)4/h2-3,5-7H,4H2,1H3,(H2,12,13,14,15);(H2,1,2,3,4) |
| InChIKey | WJGXSVMWJCSJCP-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 171.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.28 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|